C14H30O5 — CID 91218180
2-butoxy-4-(2-butoxyethoxy)butane-1,3-diol (PubChem CID 91218180) has the molecular formula C14H30O5 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-butoxy-4-(2-butoxyethoxy)butane-1,3-diol.
| Compound Name | 2-butoxy-4-(2-butoxyethoxy)butane-1,3-diol |
|---|---|
| PubChem CID | 91218180 |
| Molecular Formula | C14H30O5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-butoxy-4-(2-butoxyethoxy)butane-1,3-diol |
| SMILES | CCCCOCCOCC(O)C(CO)OCCCC |
| InChI | InChI=1S/C14H30O5/c1-3-5-7-17-9-10-18-12-13(16)14(11-15)19-8-6-4-2/h13-16H,3-12H2,1-2H3 |
| InChIKey | CIJAADUJCUDMJY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|