C24H50O6 — CID 175531662
(2S,3S,4S,5R)-2,5-di(nonoxy)hexane-1,3,4,6-tetrol (PubChem CID 175531662) has the molecular formula C24H50O6 and a molecular weight of 434.66 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2,5-di(nonoxy)hexane-1,3,4,6-tetrol.
| Compound Name | (2S,3S,4S,5R)-2,5-di(nonoxy)hexane-1,3,4,6-tetrol |
|---|---|
| PubChem CID | 175531662 |
| Molecular Formula | C24H50O6 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.36 |
| IUPAC Name | (2S,3S,4S,5R)-2,5-di(nonoxy)hexane-1,3,4,6-tetrol |
| SMILES | CCCCCCCCCO[C@@H](CO)[C@@H](O)[C@H](O)[C@@H](CO)OCCCCCCCCC |
| InChI | InChI=1S/C24H50O6/c1-3-5-7-9-11-13-15-17-29-21(19-25)23(27)24(28)22(20-26)30-18-16-14-12-10-8-6-4-2/h21-28H,3-20H2,1-2H3/t21-,22+,23-,24-/m1/s1 |
| InChIKey | CYGISRGBVUCDSM-UEQSERJNSA-N |
| XLogP | 3.96 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|