C20H42O3 — CID 14233165
(2R,3S)-3-hexadecoxybutane-1,2-diol (PubChem CID 14233165) has the molecular formula C20H42O3 and a molecular weight of 330.55 g/mol. Its IUPAC name is (2R,3S)-3-hexadecoxybutane-1,2-diol.
| Compound Name | (2R,3S)-3-hexadecoxybutane-1,2-diol |
|---|---|
| PubChem CID | 14233165 |
| Molecular Formula | C20H42O3 |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.31 |
| IUPAC Name | (2R,3S)-3-hexadecoxybutane-1,2-diol |
| SMILES | CCCCCCCCCCCCCCCCO[C@@H](C)[C@H](O)CO |
| InChI | InChI=1S/C20H42O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23-19(2)20(22)18-21/h19-22H,3-18H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | IFOGBWUDRUJLAL-VQTJNVASSA-N |
| XLogP | 5.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|