About methane;2-octadecoxypropan-1-ol
methane;2-octadecoxypropan-1-ol (PubChem CID 178185801) has the molecular formula C22H48O2
and a molecular weight of 344.62 g/mol. Its IUPAC name is methane;2-octadecoxypropan-1-ol.
Molecular Properties
| Compound Name | methane;2-octadecoxypropan-1-ol |
| PubChem CID | 178185801 |
| Molecular Formula | C22H48O2 |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.37 |
| IUPAC Name | methane;2-octadecoxypropan-1-ol |
| SMILES | C.CCCCCCCCCCCCCCCCCCOC(C)CO |
| InChI | InChI=1S/C21H44O2.CH4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-21(2)20-22;/h21-22H,3-20H2,1-2H3;1H4 |
| InChIKey | VZOXOKFILYPCFC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;2-octadecoxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-octadecoxypropan-1-ol?
The IUPAC name of methane;2-octadecoxypropan-1-ol (CID 178185801) is methane;2-octadecoxypropan-1-ol.
What is the SMILES notation for methane;2-octadecoxypropan-1-ol?
The canonical SMILES for methane;2-octadecoxypropan-1-ol is C.CCCCCCCCCCCCCCCCCCOC(C)CO.
What is the InChIKey of methane;2-octadecoxypropan-1-ol?
The InChIKey is VZOXOKFILYPCFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O2.CH4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-21(2)20-22;/h21-22H,3-20H2,1-2H3;1H4.
What are the key properties of methane;2-octadecoxypropan-1-ol?
methane;2-octadecoxypropan-1-ol has a molecular weight of 344.62 g/mol, XLogP of 7.28, 19 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-octadecoxypropan-1-ol is sourced from PubChem (CID 178185801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).