C13H30O4 — CID 162121003
2-butoxyethanol;2-butoxypropan-1-ol (PubChem CID 162121003) has the molecular formula C13H30O4 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-butoxyethanol;2-butoxypropan-1-ol.
| Compound Name | 2-butoxyethanol;2-butoxypropan-1-ol |
|---|---|
| PubChem CID | 162121003 |
| Molecular Formula | C13H30O4 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | 2-butoxyethanol;2-butoxypropan-1-ol |
| SMILES | CCCCOC(C)CO.CCCCOCCO |
| InChI | InChI=1S/C7H16O2.C6H14O2/c1-3-4-5-9-7(2)6-8;1-2-3-5-8-6-4-7/h7-8H,3-6H2,1-2H3;7H,2-6H2,1H3 |
| InChIKey | ZHKCTFFVGHGPPU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|