C11H22O4 — CID 175582035
3-hexoxy-4,5-dihydroxypentan-2-one (PubChem CID 175582035) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is 3-hexoxy-4,5-dihydroxypentan-2-one.
| Compound Name | 3-hexoxy-4,5-dihydroxypentan-2-one |
|---|---|
| PubChem CID | 175582035 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-hexoxy-4,5-dihydroxypentan-2-one |
| SMILES | CCCCCCOC(C(C)=O)C(O)CO |
| InChI | InChI=1S/C11H22O4/c1-3-4-5-6-7-15-11(9(2)13)10(14)8-12/h10-12,14H,3-8H2,1-2H3 |
| InChIKey | YSFJOPCWDFMFLX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|