C20H40O4 — CID 174734107
1,2-dihydroxy-3-pentoxypentadecan-4-one (PubChem CID 174734107) has the molecular formula C20H40O4 and a molecular weight of 344.54 g/mol. Its IUPAC name is 1,2-dihydroxy-3-pentoxypentadecan-4-one.
| Compound Name | 1,2-dihydroxy-3-pentoxypentadecan-4-one |
|---|---|
| PubChem CID | 174734107 |
| Molecular Formula | C20H40O4 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 1,2-dihydroxy-3-pentoxypentadecan-4-one |
| SMILES | CCCCCCCCCCCC(=O)C(OCCCCC)C(O)CO |
| InChI | InChI=1S/C20H40O4/c1-3-5-7-8-9-10-11-12-13-15-18(22)20(19(23)17-21)24-16-14-6-4-2/h19-21,23H,3-17H2,1-2H3 |
| InChIKey | ORXLWDGUXVMCBY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|