C10H17NO4 — CID 23191450
2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxopent-4-enoate (PubChem CID 23191450) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxopent-4-enoate.
| Compound Name | 2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxopent-4-enoate |
|---|---|
| PubChem CID | 23191450 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2-[1-hydroxy-2-(trimethylazaniumyl)ethyl]-3-oxopent-4-enoate |
| SMILES | C=CC(=O)C(C(=O)[O-])C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C10H17NO4/c1-5-7(12)9(10(14)15)8(13)6-11(2,3)4/h5,8-9,13H,1,6H2,2-4H3 |
| InChIKey | SGCRQRMKKWFOAD-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|