C20H40N2O12 — CID 21321647
bis(2,3,4-trihydroxy-4-oxobutanoate);trimethyl-[6-(trimethylazaniumyl)hexyl]azanium (PubChem CID 21321647) has the molecular formula C20H40N2O12 and a molecular weight of 500.54 g/mol. Its IUPAC name is bis(2,3,4-trihydroxy-4-oxobutanoate);trimethyl-[6-(trimethylazaniumyl)hexyl]azanium.
| Compound Name | bis(2,3,4-trihydroxy-4-oxobutanoate);trimethyl-[6-(trimethylazaniumyl)hexyl]azanium |
|---|---|
| PubChem CID | 21321647 |
| Molecular Formula | C20H40N2O12 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | bis(2,3,4-trihydroxy-4-oxobutanoate);trimethyl-[6-(trimethylazaniumyl)hexyl]azanium |
| SMILES | C[N+](C)(C)CCCCCC[N+](C)(C)C.O=C([O-])C(O)C(O)C(=O)O.O=C([O-])C(O)C(O)C(=O)O |
| InChI | InChI=1S/C12H30N2.2C4H6O6/c1-13(2,3)11-9-7-8-10-12-14(4,5)6;2*5-1(3(7)8)2(6)4(9)10/h7-12H2,1-6H3;2*1-2,5-6H,(H,7,8)(H,9,10)/q+2;;/p-2 |
| InChIKey | FBKYPSXTNBQAJW-UHFFFAOYSA-L |
| XLogP | -4.96 |
| TPSA | 235.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | -4.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|