C14H30Cl2N2O8 — CID 175565794
bis(2-chlorooxyethyl(trimethyl)azanium);2,3-dihydroxybutanedioate (PubChem CID 175565794) has the molecular formula C14H30Cl2N2O8 and a molecular weight of 425.31 g/mol. Its IUPAC name is bis(2-chlorooxyethyl(trimethyl)azanium);2,3-dihydroxybutanedioate.
| Compound Name | bis(2-chlorooxyethyl(trimethyl)azanium);2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 175565794 |
| Molecular Formula | C14H30Cl2N2O8 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | bis(2-chlorooxyethyl(trimethyl)azanium);2,3-dihydroxybutanedioate |
| SMILES | C[N+](C)(C)CCOCl.C[N+](C)(C)CCOCl.O=C([O-])C(O)C(O)C(=O)[O-] |
| InChI | InChI=1S/2C5H13ClNO.C4H6O6/c2*1-7(2,3)4-5-8-6;5-1(3(7)8)2(6)4(9)10/h2*4-5H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10)/q2*+1;/p-2 |
| InChIKey | ONAWJJOLGMUFQS-UHFFFAOYSA-L |
| XLogP | -3.07 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|