2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride

C7H15Cl2NO3 — CID 175461531

IUPAC2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride
SMILESC[N+](C)(C)CCOC(Cl)C(=O)O.[Cl-]
InChIInChI=1S/C7H14ClNO3.ClH/c1-9(2,3)4-5-12-6(8)7(10)11;/h6H,4-5H2,1-3H3;1H
InChIKeySIHRUNWYLCLOJI-UHFFFAOYSA-N
MW232.11 g/mol
LogP-2.64
Rot. Bonds5

About 2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride

2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride (PubChem CID 175461531) has the molecular formula C7H15Cl2NO3 and a molecular weight of 232.11 g/mol. Its IUPAC name is 2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride.

Molecular Properties

Compound Name2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride
PubChem CID175461531
Molecular FormulaC7H15Cl2NO3
Molecular Weight232.11 g/mol
Exact Mass231.04
IUPAC Name2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride
SMILESC[N+](C)(C)CCOC(Cl)C(=O)O.[Cl-]
InChIInChI=1S/C7H14ClNO3.ClH/c1-9(2,3)4-5-12-6(8)7(10)11;/h6H,4-5H2,1-3H3;1H
InChIKeySIHRUNWYLCLOJI-UHFFFAOYSA-N
XLogP-2.64
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.11
LogP ≤ 5-2.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze 2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride?
The IUPAC name of 2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride (CID 175461531) is 2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride.
What is the SMILES notation for 2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride?
The canonical SMILES for 2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride is C[N+](C)(C)CCOC(Cl)C(=O)O.[Cl-].
What is the InChIKey of 2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride?
The InChIKey is SIHRUNWYLCLOJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClNO3.ClH/c1-9(2,3)4-5-12-6(8)7(10)11;/h6H,4-5H2,1-3H3;1H.
What are the key properties of 2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride?
2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride has a molecular weight of 232.11 g/mol, XLogP of -2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carboxy(chloro)methoxy]ethyl-trimethylazanium chloride is sourced from PubChem (CID 175461531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).