C8H16F3N2O2+ — CID 90374847
2-(3-amino-1,1,1-trifluoro-3-oxopropan-2-yl)oxyethyl-trimethylazanium (PubChem CID 90374847) has the molecular formula C8H16F3N2O2+ and a molecular weight of 229.22 g/mol. Its IUPAC name is 2-(3-amino-1,1,1-trifluoro-3-oxopropan-2-yl)oxyethyl-trimethylazanium.
| Compound Name | 2-(3-amino-1,1,1-trifluoro-3-oxopropan-2-yl)oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 90374847 |
| Molecular Formula | C8H16F3N2O2+ |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-(3-amino-1,1,1-trifluoro-3-oxopropan-2-yl)oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOC(C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2/c1-13(2,3)4-5-15-6(7(12)14)8(9,10)11/h6H,4-5H2,1-3H3,(H-,12,14)/p+1 |
| InChIKey | VPJXVMNTWYQMOM-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|