C16H36NO2+ — CID 123439848
2-(2-tert-butyl-1-hydroxy-2,3,3-trimethylbutoxy)ethyl-trimethylazanium (PubChem CID 123439848) has the molecular formula C16H36NO2+ and a molecular weight of 274.47 g/mol. Its IUPAC name is 2-(2-tert-butyl-1-hydroxy-2,3,3-trimethylbutoxy)ethyl-trimethylazanium.
| Compound Name | 2-(2-tert-butyl-1-hydroxy-2,3,3-trimethylbutoxy)ethyl-trimethylazanium |
|---|---|
| PubChem CID | 123439848 |
| Molecular Formula | C16H36NO2+ |
| Molecular Weight | 274.47 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 2-(2-tert-butyl-1-hydroxy-2,3,3-trimethylbutoxy)ethyl-trimethylazanium |
| SMILES | CC(C)(C)C(C)(C(O)OCC[N+](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H36NO2/c1-14(2,3)16(7,15(4,5)6)13(18)19-12-11-17(8,9)10/h13,18H,11-12H2,1-10H3/q+1 |
| InChIKey | VLHJGXAYXYYJKQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|