C12H26NO2+ — CID 20759371
trimethyl-[2-(2,3,3-trimethylbutanoyloxy)ethyl]azanium (PubChem CID 20759371) has the molecular formula C12H26NO2+ and a molecular weight of 216.34 g/mol. Its IUPAC name is trimethyl-[2-(2,3,3-trimethylbutanoyloxy)ethyl]azanium.
| Compound Name | trimethyl-[2-(2,3,3-trimethylbutanoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 20759371 |
| Molecular Formula | C12H26NO2+ |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | trimethyl-[2-(2,3,3-trimethylbutanoyloxy)ethyl]azanium |
| SMILES | CC(C(=O)OCC[N+](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H26NO2/c1-10(12(2,3)4)11(14)15-9-8-13(5,6)7/h10H,8-9H2,1-7H3/q+1 |
| InChIKey | YBFFTDKRIYNMEU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|