About barium(2+);2-carbamoyloxyethyl(trimethyl)azanium
barium(2+);2-carbamoyloxyethyl(trimethyl)azanium (PubChem CID 88516621) has the molecular formula C6H15BaN2O2+3
and a molecular weight of 284.53 g/mol. Its IUPAC name is barium(2+);2-carbamoyloxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | barium(2+);2-carbamoyloxyethyl(trimethyl)azanium |
| PubChem CID | 88516621 |
| Molecular Formula | C6H15BaN2O2+3 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | barium(2+);2-carbamoyloxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCOC(N)=O.[Ba+2] |
| InChI | InChI=1S/C6H14N2O2.Ba/c1-8(2,3)4-5-10-6(7)9;/h4-5H2,1-3H3,(H-,7,9);/q;+2/p+1 |
| InChIKey | IJDJDJJLFATQPC-UHFFFAOYSA-O |
| XLogP | -0.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);2-carbamoyloxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);2-carbamoyloxyethyl(trimethyl)azanium?
The IUPAC name of barium(2+);2-carbamoyloxyethyl(trimethyl)azanium (CID 88516621) is barium(2+);2-carbamoyloxyethyl(trimethyl)azanium.
What is the SMILES notation for barium(2+);2-carbamoyloxyethyl(trimethyl)azanium?
The canonical SMILES for barium(2+);2-carbamoyloxyethyl(trimethyl)azanium is C[N+](C)(C)CCOC(N)=O.[Ba+2].
What is the InChIKey of barium(2+);2-carbamoyloxyethyl(trimethyl)azanium?
The InChIKey is IJDJDJJLFATQPC-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H14N2O2.Ba/c1-8(2,3)4-5-10-6(7)9;/h4-5H2,1-3H3,(H-,7,9);/q;+2/p+1.
What are the key properties of barium(2+);2-carbamoyloxyethyl(trimethyl)azanium?
barium(2+);2-carbamoyloxyethyl(trimethyl)azanium has a molecular weight of 284.53 g/mol, XLogP of -0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);2-carbamoyloxyethyl(trimethyl)azanium is sourced from PubChem (CID 88516621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).