About 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane
2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane (PubChem CID 159618935) has the molecular formula C12H32NO2+
and a molecular weight of 222.39 g/mol. Its IUPAC name is 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane.
Molecular Properties
| Compound Name | 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane |
| PubChem CID | 159618935 |
| Molecular Formula | C12H32NO2+ |
| Molecular Weight | 222.39 g/mol |
| Exact Mass | 222.24 |
| IUPAC Name | 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane |
| SMILES | C.C.CCC(C)C(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C10H24NO2.2CH4/c1-6-9(2)10(12)13-8-7-11(3,4)5;;/h9-10,12H,6-8H2,1-5H3;2*1H4/q+1;; |
| InChIKey | MNQKMCAHLCYDFC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane?
The IUPAC name of 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane (CID 159618935) is 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane.
What is the SMILES notation for 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane?
The canonical SMILES for 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane is C.C.CCC(C)C(O)OCC[N+](C)(C)C.
What is the InChIKey of 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane?
The InChIKey is MNQKMCAHLCYDFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24NO2.2CH4/c1-6-9(2)10(12)13-8-7-11(3,4)5;;/h9-10,12H,6-8H2,1-5H3;2*1H4/q+1;;.
What are the key properties of 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane?
2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane has a molecular weight of 222.39 g/mol, XLogP of 2.35, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-2-methylbutoxy)ethyl-trimethylazanium;methane is sourced from PubChem (CID 159618935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).