C14H32NO2+ — CID 167404062
2-[3-[(2R)-3,3-dimethylbutan-2-yl]oxypropoxy]ethyl-trimethylazanium (PubChem CID 167404062) has the molecular formula C14H32NO2+ and a molecular weight of 246.41 g/mol. Its IUPAC name is 2-[3-[(2R)-3,3-dimethylbutan-2-yl]oxypropoxy]ethyl-trimethylazanium.
| Compound Name | 2-[3-[(2R)-3,3-dimethylbutan-2-yl]oxypropoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 167404062 |
| Molecular Formula | C14H32NO2+ |
| Molecular Weight | 246.41 g/mol |
| Exact Mass | 246.24 |
| IUPAC Name | 2-[3-[(2R)-3,3-dimethylbutan-2-yl]oxypropoxy]ethyl-trimethylazanium |
| SMILES | C[C@@H](OCCCOCC[N+](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H32NO2/c1-13(14(2,3)4)17-11-8-10-16-12-9-15(5,6)7/h13H,8-12H2,1-7H3/q+1/t13-/m1/s1 |
| InChIKey | LPEMUSFFMZTMHN-CYBMUJFWSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|