C10H21ClN2O4 — CID 3028000
2-(2-amino-4-carboxybutanoyl)oxyethyl-trimethylazanium chloride (PubChem CID 3028000) has the molecular formula C10H21ClN2O4 and a molecular weight of 268.74 g/mol. Its IUPAC name is 2-(2-amino-4-carboxybutanoyl)oxyethyl-trimethylazanium chloride.
| Compound Name | 2-(2-amino-4-carboxybutanoyl)oxyethyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 3028000 |
| Molecular Formula | C10H21ClN2O4 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-(2-amino-4-carboxybutanoyl)oxyethyl-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CCOC(=O)C(N)CCC(=O)O.[Cl-] |
| InChI | InChI=1S/C10H20N2O4.ClH/c1-12(2,3)6-7-16-10(15)8(11)4-5-9(13)14;/h8H,4-7,11H2,1-3H3;1H |
| InChIKey | PVJSRTLSDUPMAF-UHFFFAOYSA-N |
| XLogP | -3.57 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|