C8H13N7O4 — CID 141237869
(4S)-4-amino-5-(3,3-diazidopropoxy)-5-oxopentanoic acid (PubChem CID 141237869) has the molecular formula C8H13N7O4 and a molecular weight of 271.24 g/mol. Its IUPAC name is (4S)-4-amino-5-(3,3-diazidopropoxy)-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-(3,3-diazidopropoxy)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 141237869 |
| Molecular Formula | C8H13N7O4 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (4S)-4-amino-5-(3,3-diazidopropoxy)-5-oxopentanoic acid |
| SMILES | [N-]=[N+]=NC(CCOC(=O)[C@@H](N)CCC(=O)O)N=[N+]=[N-] |
| InChI | InChI=1S/C8H13N7O4/c9-5(1-2-7(16)17)8(18)19-4-3-6(12-14-10)13-15-11/h5-6H,1-4,9H2,(H,16,17)/t5-/m0/s1 |
| InChIKey | GNGXYRRWQIPZTL-YFKPBYRVSA-N |
| XLogP | 1.06 |
| TPSA | 187.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|