C16H34N2O7 — CID 146306787
4-amino-5-oxo-5-pentoxypentanoic acid;2-[bis(2-hydroxyethyl)amino]ethanol (PubChem CID 146306787) has the molecular formula C16H34N2O7 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-amino-5-oxo-5-pentoxypentanoic acid;2-[bis(2-hydroxyethyl)amino]ethanol.
| Compound Name | 4-amino-5-oxo-5-pentoxypentanoic acid;2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 146306787 |
| Molecular Formula | C16H34N2O7 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-amino-5-oxo-5-pentoxypentanoic acid;2-[bis(2-hydroxyethyl)amino]ethanol |
| SMILES | CCCCCOC(=O)C(N)CCC(=O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C10H19NO4.C6H15NO3/c1-2-3-4-7-15-10(14)8(11)5-6-9(12)13;8-4-1-7(2-5-9)3-6-10/h8H,2-7,11H2,1H3,(H,12,13);8-10H,1-6H2 |
| InChIKey | UBQGOIXBXIUJRI-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|