About disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride
disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride (PubChem CID 173171637) has the molecular formula C10H21NNa2O4
and a molecular weight of 265.26 g/mol. Its IUPAC name is disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride.
Molecular Properties
| Compound Name | disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride |
| PubChem CID | 173171637 |
| Molecular Formula | C10H21NNa2O4 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride |
| SMILES | CCCCCOC(=O)C(N)CCC(=O)O.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C10H19NO4.2Na.2H/c1-2-3-4-7-15-10(14)8(11)5-6-9(12)13;;;;/h8H,2-7,11H2,1H3,(H,12,13);;;;/q;2*+1;2*-1 |
| InChIKey | SOSBSYYAGGAKLH-UHFFFAOYSA-N |
| XLogP | -4.86 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride?
The IUPAC name of disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride (CID 173171637) is disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride.
What is the SMILES notation for disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride?
The canonical SMILES for disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride is CCCCCOC(=O)C(N)CCC(=O)O.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride?
The InChIKey is SOSBSYYAGGAKLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4.2Na.2H/c1-2-3-4-7-15-10(14)8(11)5-6-9(12)13;;;;/h8H,2-7,11H2,1H3,(H,12,13);;;;/q;2*+1;2*-1.
What are the key properties of disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride?
disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride has a molecular weight of 265.26 g/mol, XLogP of -4.86, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;4-amino-5-oxo-5-pentoxypentanoic acid;hydride is sourced from PubChem (CID 173171637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).