C15H28N5O7S+ — CID 23634192
2-[(2S)-2-amino-5-[[(2S)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoyl]oxyethyl-trimethylazanium (PubChem CID 23634192) has the molecular formula C15H28N5O7S+ and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[(2S)-2-amino-5-[[(2S)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(2S)-2-amino-5-[[(2S)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 23634192 |
| Molecular Formula | C15H28N5O7S+ |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[(2S)-2-amino-5-[[(2S)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoyl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOC(=O)[C@@H](N)CCC(=O)N[C@H](CSN=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C15H27N5O7S/c1-20(2,3)6-7-27-15(25)10(16)4-5-12(21)18-11(9-28-19-26)14(24)17-8-13(22)23/h10-11H,4-9,16H2,1-3H3,(H2-,17,18,21,22,23,24)/p+1/t10-,11+/m0/s1 |
| InChIKey | BJPWCPXEAWPPAY-WDEREUQCSA-O |
| XLogP | -1.56 |
| TPSA | 177.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|