C15H26N4O7S — CID 87191915
(2S)-5-[[(2R)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxo-2-(pentylamino)pentanoic acid (PubChem CID 87191915) has the molecular formula C15H26N4O7S and a molecular weight of 406.46 g/mol. Its IUPAC name is (2S)-5-[[(2R)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxo-2-(pentylamino)pentanoic acid.
| Compound Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxo-2-(pentylamino)pentanoic acid |
|---|---|
| PubChem CID | 87191915 |
| Molecular Formula | C15H26N4O7S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (2S)-5-[[(2R)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxo-2-(pentylamino)pentanoic acid |
| SMILES | CCCCCN[C@@H](CCC(=O)N[C@@H](CSN=O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H26N4O7S/c1-2-3-4-7-16-10(15(24)25)5-6-12(20)18-11(9-27-19-26)14(23)17-8-13(21)22/h10-11,16H,2-9H2,1H3,(H,17,23)(H,18,20)(H,21,22)(H,24,25)/t10-,11-/m0/s1 |
| InChIKey | QXDNACGAOYLFOZ-QWRGUYRKSA-N |
| XLogP | 0.10 |
| TPSA | 174.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|