C10H18N4O8S — CID 171777167
(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid;hydrate (PubChem CID 171777167) has the molecular formula C10H18N4O8S and a molecular weight of 354.34 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid;hydrate.
| Compound Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid;hydrate |
|---|---|
| PubChem CID | 171777167 |
| Molecular Formula | C10H18N4O8S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid;hydrate |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSN=O)C(=O)NCC(=O)O)C(=O)O.O |
| InChI | InChI=1S/C10H16N4O7S.H2O/c11-5(10(19)20)1-2-7(15)13-6(4-22-14-21)9(18)12-3-8(16)17;/h5-6H,1-4,11H2,(H,12,18)(H,13,15)(H,16,17)(H,19,20);1H2/t5-,6-;/m0./s1 |
| InChIKey | JWNLUXLMLKHHJK-GEMLJDPKSA-N |
| XLogP | -2.55 |
| TPSA | 219.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|