C10H18N3O9PS — CID 14368898
2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-phosphonosulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 14368898) has the molecular formula C10H18N3O9PS and a molecular weight of 387.31 g/mol. Its IUPAC name is 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-phosphonosulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-phosphonosulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 14368898 |
| Molecular Formula | C10H18N3O9PS |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-phosphonosulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)NC(CSP(=O)(O)O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H18N3O9PS/c11-5(10(18)19)1-2-7(14)13-6(4-24-23(20,21)22)9(17)12-3-8(15)16/h5-6H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)(H2,20,21,22) |
| InChIKey | FNVSLLUILFQMFU-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 216.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|