C10H16N4O6S2 — CID 175606443
2-[[2-[(4-amino-5-oxo-5-sulfanylpentanoyl)amino]-3-nitrososulfanylpropanoyl]amino]acetic acid (PubChem CID 175606443) has the molecular formula C10H16N4O6S2 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[[2-[(4-amino-5-oxo-5-sulfanylpentanoyl)amino]-3-nitrososulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[(4-amino-5-oxo-5-sulfanylpentanoyl)amino]-3-nitrososulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 175606443 |
| Molecular Formula | C10H16N4O6S2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-[[2-[(4-amino-5-oxo-5-sulfanylpentanoyl)amino]-3-nitrososulfanylpropanoyl]amino]acetic acid |
| SMILES | NC(CCC(=O)NC(CSN=O)C(=O)NCC(=O)O)C(=O)S |
| InChI | InChI=1S/C10H16N4O6S2/c11-5(10(19)21)1-2-7(15)13-6(4-22-14-20)9(18)12-3-8(16)17/h5-6H,1-4,11H2,(H,12,18)(H,13,15)(H,16,17)(H,19,21) |
| InChIKey | OCHLZIOSRHIRSX-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 168.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|