C19H32N4O8S — CID 170205804
methyl (2S)-5-[[(2R)-1-[(2-ethoxy-2-oxoethyl)amino]-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-2-(hexanoylamino)-5-oxopentanoate (PubChem CID 170205804) has the molecular formula C19H32N4O8S and a molecular weight of 476.55 g/mol. Its IUPAC name is methyl (2S)-5-[[(2R)-1-[(2-ethoxy-2-oxoethyl)amino]-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-2-(hexanoylamino)-5-oxopentanoate.
| Compound Name | methyl (2S)-5-[[(2R)-1-[(2-ethoxy-2-oxoethyl)amino]-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-2-(hexanoylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 170205804 |
| Molecular Formula | C19H32N4O8S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | methyl (2S)-5-[[(2R)-1-[(2-ethoxy-2-oxoethyl)amino]-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-2-(hexanoylamino)-5-oxopentanoate |
| SMILES | CCCCCC(=O)N[C@@H](CCC(=O)N[C@@H](CSN=O)C(=O)NCC(=O)OCC)C(=O)OC |
| InChI | InChI=1S/C19H32N4O8S/c1-4-6-7-8-15(24)21-13(19(28)30-3)9-10-16(25)22-14(12-32-23-29)18(27)20-11-17(26)31-5-2/h13-14H,4-12H2,1-3H3,(H,20,27)(H,21,24)(H,22,25)/t13-,14-/m0/s1 |
| InChIKey | QVKHYSILDKVEHY-KBPBESRZSA-N |
| XLogP | 0.58 |
| TPSA | 169.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|