C13H21CaN3O8S — CID 172734642
CID 172734642 (PubChem CID 172734642) has the molecular formula C13H21CaN3O8S and a molecular weight of 419.47 g/mol.
| Compound Name | CID 172734642 |
|---|---|
| PubChem CID | 172734642 |
| Molecular Formula | C13H21CaN3O8S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | — |
| SMILES | CC(O)C(=O)SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O.[Ca] |
| InChI | InChI=1S/C13H21N3O8S.Ca/c1-6(17)13(24)25-5-8(11(21)15-4-10(19)20)16-9(18)3-2-7(14)12(22)23;/h6-8,17H,2-5,14H2,1H3,(H,15,21)(H,16,18)(H,19,20)(H,22,23);/t6?,7-,8-;/m0./s1 |
| InChIKey | IGLRVNZNMVTNKZ-VRNPKMDQSA-N |
| XLogP | -2.88 |
| TPSA | 196.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|