C14H16Cl5N3O6S — CID 3035006
(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-[(1E)-1,2,3,4,4-pentachlorobuta-1,3-dienyl]sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 3035006) has the molecular formula C14H16Cl5N3O6S and a molecular weight of 531.63 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-[(1E)-1,2,3,4,4-pentachlorobuta-1,3-dienyl]sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-[(1E)-1,2,3,4,4-pentachlorobuta-1,3-dienyl]sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 3035006 |
| Molecular Formula | C14H16Cl5N3O6S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 528.92 |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-[(1E)-1,2,3,4,4-pentachlorobuta-1,3-dienyl]sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS/C(Cl)=C(\Cl)C(Cl)=C(Cl)Cl)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H16Cl5N3O6S/c15-9(11(17)18)10(16)12(19)29-4-6(13(26)21-3-8(24)25)22-7(23)2-1-5(20)14(27)28/h5-6H,1-4,20H2,(H,21,26)(H,22,23)(H,24,25)(H,27,28)/b12-10-/t5-,6-/m0/s1 |
| InChIKey | VZRXIAGWZWMHMI-YTSWDMLESA-N |
| XLogP | 2.13 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|