C15H29N4O6S+ — CID 23582132
2-[2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]oxyethyl-trimethylazanium (PubChem CID 23582132) has the molecular formula C15H29N4O6S+ and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 23582132 |
| Molecular Formula | C15H29N4O6S+ |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-[2-[[(2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOC(=O)CNC(=O)[C@@H](CS)NC(=O)[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C15H28N4O6S/c1-19(2,3)6-7-25-13(22)8-17-15(24)11(9-26)18-14(23)10(16)4-5-12(20)21/h10-11H,4-9,16H2,1-3H3,(H3-,17,18,20,21,23,24,26)/p+1/t10-,11+/m0/s1 |
| InChIKey | WYBYRJGSZPNWJA-WDEREUQCSA-O |
| XLogP | -2.04 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|