C19H41NO7 — CID 139993076
decyl(trimethyl)azanium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 139993076) has the molecular formula C19H41NO7 and a molecular weight of 395.54 g/mol. Its IUPAC name is decyl(trimethyl)azanium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | decyl(trimethyl)azanium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 139993076 |
| Molecular Formula | C19H41NO7 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | decyl(trimethyl)azanium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | CCCCCCCCCC[N+](C)(C)C.O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H30N.C6H12O7/c1-5-6-7-8-9-10-11-12-13-14(2,3)4;7-1-2(8)3(9)4(10)5(11)6(12)13/h5-13H2,1-4H3;2-5,7-11H,1H2,(H,12,13)/q+1;/p-1/t;2-,3-,4+,5-/m.1/s1 |
| InChIKey | PPXMKAXAIPICRA-IFWQJVLJSA-M |
| XLogP | -0.99 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|