C11H21ClNO3+ — CID 174412638
(3-chloro-2-hydroxypropyl)-(2-hydroxy-4-methyl-3-oxopent-4-enyl)-dimethylazanium (PubChem CID 174412638) has the molecular formula C11H21ClNO3+ and a molecular weight of 250.75 g/mol. Its IUPAC name is (3-chloro-2-hydroxypropyl)-(2-hydroxy-4-methyl-3-oxopent-4-enyl)-dimethylazanium.
| Compound Name | (3-chloro-2-hydroxypropyl)-(2-hydroxy-4-methyl-3-oxopent-4-enyl)-dimethylazanium |
|---|---|
| PubChem CID | 174412638 |
| Molecular Formula | C11H21ClNO3+ |
| Molecular Weight | 250.75 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (3-chloro-2-hydroxypropyl)-(2-hydroxy-4-methyl-3-oxopent-4-enyl)-dimethylazanium |
| SMILES | C=C(C)C(=O)C(O)C[N+](C)(C)CC(O)CCl |
| InChI | InChI=1S/C11H21ClNO3/c1-8(2)11(16)10(15)7-13(3,4)6-9(14)5-12/h9-10,14-15H,1,5-7H2,2-4H3/q+1 |
| InChIKey | REIOELLJCMIHDL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.75 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|