C11H21Cl2NO3 — CID 88759532
(5-chloro-4-hydroxypentan-2-yl)-dimethyl-(2-methylprop-2-enoyloxy)azanium chloride (PubChem CID 88759532) has the molecular formula C11H21Cl2NO3 and a molecular weight of 286.20 g/mol. Its IUPAC name is (5-chloro-4-hydroxypentan-2-yl)-dimethyl-(2-methylprop-2-enoyloxy)azanium chloride.
| Compound Name | (5-chloro-4-hydroxypentan-2-yl)-dimethyl-(2-methylprop-2-enoyloxy)azanium chloride |
|---|---|
| PubChem CID | 88759532 |
| Molecular Formula | C11H21Cl2NO3 |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | (5-chloro-4-hydroxypentan-2-yl)-dimethyl-(2-methylprop-2-enoyloxy)azanium chloride |
| SMILES | C=C(C)C(=O)O[N+](C)(C)C(C)CC(O)CCl.[Cl-] |
| InChI | InChI=1S/C11H21ClNO3.ClH/c1-8(2)11(15)16-13(4,5)9(3)6-10(14)7-12;/h9-10,14H,1,6-7H2,2-5H3;1H/q+1;/p-1 |
| InChIKey | OJPVQBORINPKHE-UHFFFAOYSA-M |
| XLogP | -1.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|