C8H13ClO3 — CID 45378845
3-(3-chloro-2-hydroxypropyl)pentane-2,4-dione (PubChem CID 45378845) has the molecular formula C8H13ClO3 and a molecular weight of 192.64 g/mol. Its IUPAC name is 3-(3-chloro-2-hydroxypropyl)pentane-2,4-dione.
| Compound Name | 3-(3-chloro-2-hydroxypropyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 45378845 |
| Molecular Formula | C8H13ClO3 |
| Molecular Weight | 192.64 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 3-(3-chloro-2-hydroxypropyl)pentane-2,4-dione |
| SMILES | CC(=O)C(CC(O)CCl)C(C)=O |
| InChI | InChI=1S/C8H13ClO3/c1-5(10)8(6(2)11)3-7(12)4-9/h7-8,12H,3-4H2,1-2H3 |
| InChIKey | LRISKSFQPYFZPC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.64 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|