C7H12ClO6P — CID 87407373
[(3-chloro-2-hydroxypropoxy)-hydroxyphosphoryl] 2-methylprop-2-enoate (PubChem CID 87407373) has the molecular formula C7H12ClO6P and a molecular weight of 258.59 g/mol. Its IUPAC name is [(3-chloro-2-hydroxypropoxy)-hydroxyphosphoryl] 2-methylprop-2-enoate.
| Compound Name | [(3-chloro-2-hydroxypropoxy)-hydroxyphosphoryl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87407373 |
| Molecular Formula | C7H12ClO6P |
| Molecular Weight | 258.59 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | [(3-chloro-2-hydroxypropoxy)-hydroxyphosphoryl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OP(=O)(O)OCC(O)CCl |
| InChI | InChI=1S/C7H12ClO6P/c1-5(2)7(10)14-15(11,12)13-4-6(9)3-8/h6,9H,1,3-4H2,2H3,(H,11,12) |
| InChIKey | DJLDMWYERHXJCS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.59 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|