C4H8NaO5P — CID 174967425
sodium;hydride;phosphono 2-methylprop-2-enoate (PubChem CID 174967425) has the molecular formula C4H8NaO5P and a molecular weight of 190.07 g/mol. Its IUPAC name is sodium;hydride;phosphono 2-methylprop-2-enoate.
| Compound Name | sodium;hydride;phosphono 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174967425 |
| Molecular Formula | C4H8NaO5P |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | sodium;hydride;phosphono 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C4H7O5P.Na.H/c1-3(2)4(5)9-10(6,7)8;;/h1H2,2H3,(H2,6,7,8);;/q;+1;-1 |
| InChIKey | FZDIHEMZEJGGHM-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|