About sodium;acetyl 2-methylprop-2-enoate;hydride
sodium;acetyl 2-methylprop-2-enoate;hydride (PubChem CID 174757857) has the molecular formula C6H9NaO3
and a molecular weight of 152.12 g/mol. Its IUPAC name is sodium;acetyl 2-methylprop-2-enoate;hydride.
Molecular Properties
| Compound Name | sodium;acetyl 2-methylprop-2-enoate;hydride |
| PubChem CID | 174757857 |
| Molecular Formula | C6H9NaO3 |
| Molecular Weight | 152.12 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | sodium;acetyl 2-methylprop-2-enoate;hydride |
| SMILES | C=C(C)C(=O)OC(C)=O.[H-].[Na+] |
| InChI | InChI=1S/C6H8O3.Na.H/c1-4(2)6(8)9-5(3)7;;/h1H2,2-3H3;;/q;+1;-1 |
| InChIKey | UUYDXMHOOAKLEJ-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.12 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;acetyl 2-methylprop-2-enoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;acetyl 2-methylprop-2-enoate;hydride?
The IUPAC name of sodium;acetyl 2-methylprop-2-enoate;hydride (CID 174757857) is sodium;acetyl 2-methylprop-2-enoate;hydride.
What is the SMILES notation for sodium;acetyl 2-methylprop-2-enoate;hydride?
The canonical SMILES for sodium;acetyl 2-methylprop-2-enoate;hydride is C=C(C)C(=O)OC(C)=O.[H-].[Na+].
What is the InChIKey of sodium;acetyl 2-methylprop-2-enoate;hydride?
The InChIKey is UUYDXMHOOAKLEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3.Na.H/c1-4(2)6(8)9-5(3)7;;/h1H2,2-3H3;;/q;+1;-1.
What are the key properties of sodium;acetyl 2-methylprop-2-enoate;hydride?
sodium;acetyl 2-methylprop-2-enoate;hydride has a molecular weight of 152.12 g/mol, XLogP of -2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;acetyl 2-methylprop-2-enoate;hydride is sourced from PubChem (CID 174757857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).