C12H20O8 — CID 174807488
acetyl 2-methylprop-2-enoate;2-[2-(2-hydroxyethoxy)ethoxy]acetic acid (PubChem CID 174807488) has the molecular formula C12H20O8 and a molecular weight of 292.28 g/mol. Its IUPAC name is acetyl 2-methylprop-2-enoate;2-[2-(2-hydroxyethoxy)ethoxy]acetic acid.
| Compound Name | acetyl 2-methylprop-2-enoate;2-[2-(2-hydroxyethoxy)ethoxy]acetic acid |
|---|---|
| PubChem CID | 174807488 |
| Molecular Formula | C12H20O8 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | acetyl 2-methylprop-2-enoate;2-[2-(2-hydroxyethoxy)ethoxy]acetic acid |
| SMILES | C=C(C)C(=O)OC(C)=O.O=C(O)COCCOCCO |
| InChI | InChI=1S/C6H12O5.C6H8O3/c7-1-2-10-3-4-11-5-6(8)9;1-4(2)6(8)9-5(3)7/h7H,1-5H2,(H,8,9);1H2,2-3H3 |
| InChIKey | NHZUPQIPHWTPNU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|