C8H12O5 — CID 23168599
2-[2-(2-methylprop-2-enoyloxy)ethoxy]acetic acid (PubChem CID 23168599) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)ethoxy]acetic acid.
| Compound Name | 2-[2-(2-methylprop-2-enoyloxy)ethoxy]acetic acid |
|---|---|
| PubChem CID | 23168599 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyloxy)ethoxy]acetic acid |
| SMILES | C=C(C)C(=O)OCCOCC(=O)O |
| InChI | InChI=1S/C8H12O5/c1-6(2)8(11)13-4-3-12-5-7(9)10/h1,3-5H2,2H3,(H,9,10) |
| InChIKey | BLSCWACAKUHBOC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|