About 2-methylprop-2-enoyloxymethanethioic S-acid
2-methylprop-2-enoyloxymethanethioic S-acid (PubChem CID 175561499) has the molecular formula C5H6O3S
and a molecular weight of 146.17 g/mol. Its IUPAC name is 2-methylprop-2-enoyloxymethanethioic S-acid.
Molecular Properties
| Compound Name | 2-methylprop-2-enoyloxymethanethioic S-acid |
| PubChem CID | 175561499 |
| Molecular Formula | C5H6O3S |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 2-methylprop-2-enoyloxymethanethioic S-acid |
| SMILES | C=C(C)C(=O)OC(=O)S |
| InChI | InChI=1S/C5H6O3S/c1-3(2)4(6)8-5(7)9/h1H2,2H3,(H,7,9) |
| InChIKey | MTAVVLUOMOGGHC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoyloxymethanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoyloxymethanethioic S-acid?
The IUPAC name of 2-methylprop-2-enoyloxymethanethioic S-acid (CID 175561499) is 2-methylprop-2-enoyloxymethanethioic S-acid.
What is the SMILES notation for 2-methylprop-2-enoyloxymethanethioic S-acid?
The canonical SMILES for 2-methylprop-2-enoyloxymethanethioic S-acid is C=C(C)C(=O)OC(=O)S.
What is the InChIKey of 2-methylprop-2-enoyloxymethanethioic S-acid?
The InChIKey is MTAVVLUOMOGGHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3S/c1-3(2)4(6)8-5(7)9/h1H2,2H3,(H,7,9).
What are the key properties of 2-methylprop-2-enoyloxymethanethioic S-acid?
2-methylprop-2-enoyloxymethanethioic S-acid has a molecular weight of 146.17 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoyloxymethanethioic S-acid is sourced from PubChem (CID 175561499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).