About disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate
disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate (PubChem CID 174917305) has the molecular formula C10H16O3S2
and a molecular weight of 248.37 g/mol. Its IUPAC name is disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate |
| PubChem CID | 174917305 |
| Molecular Formula | C10H16O3S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)C(=C)C.CCSS |
| InChI | InChI=1S/C8H10O3.C2H6S2/c1-5(2)7(9)11-8(10)6(3)4;1-2-4-3/h1,3H2,2,4H3;3H,2H2,1H3 |
| InChIKey | QGRHOUWBWYEHPY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate?
The IUPAC name of disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate (CID 174917305) is disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate.
What is the SMILES notation for disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate?
The canonical SMILES for disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate is C=C(C)C(=O)OC(=O)C(=C)C.CCSS.
What is the InChIKey of disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate?
The InChIKey is QGRHOUWBWYEHPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3.C2H6S2/c1-5(2)7(9)11-8(10)6(3)4;1-2-4-3/h1,3H2,2,4H3;3H,2H2,1H3.
What are the key properties of disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate?
disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate has a molecular weight of 248.37 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disulfanylethane;2-methylprop-2-enoyl 2-methylprop-2-enoate is sourced from PubChem (CID 174917305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).