C16H26O4S3 — CID 174829829
[1-ethylsulfanyl-2-[2-ethylsulfanyl-2-(2-methylprop-2-enoyloxy)ethyl]sulfanylethyl] 2-methylprop-2-enoate (PubChem CID 174829829) has the molecular formula C16H26O4S3 and a molecular weight of 378.58 g/mol. Its IUPAC name is [1-ethylsulfanyl-2-[2-ethylsulfanyl-2-(2-methylprop-2-enoyloxy)ethyl]sulfanylethyl] 2-methylprop-2-enoate.
| Compound Name | [1-ethylsulfanyl-2-[2-ethylsulfanyl-2-(2-methylprop-2-enoyloxy)ethyl]sulfanylethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174829829 |
| Molecular Formula | C16H26O4S3 |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [1-ethylsulfanyl-2-[2-ethylsulfanyl-2-(2-methylprop-2-enoyloxy)ethyl]sulfanylethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CSCC(OC(=O)C(=C)C)SCC)SCC |
| InChI | InChI=1S/C16H26O4S3/c1-7-22-13(19-15(17)11(3)4)9-21-10-14(23-8-2)20-16(18)12(5)6/h13-14H,3,5,7-10H2,1-2,4,6H3 |
| InChIKey | YLKLPPQWELDRGH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|