C13H18O3 — CID 87864709
2-methylbuta-1,3-diene;2-methylprop-2-enoyl 2-methylprop-2-enoate (PubChem CID 87864709) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;2-methylprop-2-enoyl 2-methylprop-2-enoate.
| Compound Name | 2-methylbuta-1,3-diene;2-methylprop-2-enoyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87864709 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-methylbuta-1,3-diene;2-methylprop-2-enoyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)C(=C)C.C=CC(=C)C |
| InChI | InChI=1S/C8H10O3.C5H8/c1-5(2)7(9)11-8(10)6(3)4;1-4-5(2)3/h1,3H2,2,4H3;4H,1-2H2,3H3 |
| InChIKey | UWWNWAHHAZHDGR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|