C11H18O5 — CID 87815570
butane-1,4-diol;prop-2-enoyl 2-methylprop-2-enoate (PubChem CID 87815570) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is butane-1,4-diol;prop-2-enoyl 2-methylprop-2-enoate.
| Compound Name | butane-1,4-diol;prop-2-enoyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87815570 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | butane-1,4-diol;prop-2-enoyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OC(=O)C(=C)C.OCCCCO |
| InChI | InChI=1S/C7H8O3.C4H10O2/c1-4-6(8)10-7(9)5(2)3;5-3-1-2-4-6/h4H,1-2H2,3H3;5-6H,1-4H2 |
| InChIKey | MXSGDTDERCHHOH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|