C27H54O10 — CID 161182870
methane;2-(2-methylprop-2-enoyloxy)ethyl 6-hydroxyhexanoate;2-prop-2-enoyloxyethyl 6-hydroxyhexanoate (PubChem CID 161182870) has the molecular formula C27H54O10 and a molecular weight of 538.72 g/mol. Its IUPAC name is methane;2-(2-methylprop-2-enoyloxy)ethyl 6-hydroxyhexanoate;2-prop-2-enoyloxyethyl 6-hydroxyhexanoate.
| Compound Name | methane;2-(2-methylprop-2-enoyloxy)ethyl 6-hydroxyhexanoate;2-prop-2-enoyloxyethyl 6-hydroxyhexanoate |
|---|---|
| PubChem CID | 161182870 |
| Molecular Formula | C27H54O10 |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | methane;2-(2-methylprop-2-enoyloxy)ethyl 6-hydroxyhexanoate;2-prop-2-enoyloxyethyl 6-hydroxyhexanoate |
| SMILES | C.C.C.C.C=C(C)C(=O)OCCOC(=O)CCCCCO.C=CC(=O)OCCOC(=O)CCCCCO |
| InChI | InChI=1S/C12H20O5.C11H18O5.4CH4/c1-10(2)12(15)17-9-8-16-11(14)6-4-3-5-7-13;1-2-10(13)15-8-9-16-11(14)6-4-3-5-7-12;;;;/h13H,1,3-9H2,2H3;2,12H,1,3-9H2;4*1H4 |
| InChIKey | USRWMLSXMPUDFV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|