C9H12O3 — CID 166124468
[(1Z)-1-hydroxy-2-methylbuta-1,3-dienyl] 2-methylprop-2-enoate (PubChem CID 166124468) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is [(1Z)-1-hydroxy-2-methylbuta-1,3-dienyl] 2-methylprop-2-enoate.
| Compound Name | [(1Z)-1-hydroxy-2-methylbuta-1,3-dienyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166124468 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | [(1Z)-1-hydroxy-2-methylbuta-1,3-dienyl] 2-methylprop-2-enoate |
| SMILES | C=C/C(C)=C(/O)OC(=O)C(=C)C |
| InChI | InChI=1S/C9H12O3/c1-5-7(4)9(11)12-8(10)6(2)3/h5,11H,1-2H2,3-4H3/b9-7- |
| InChIKey | FWGFVMCZCGOZLB-CLFYSBASSA-N |
| XLogP | 2.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|