About phosphono 3-ethyl-2-methylpent-2-enoate
phosphono 3-ethyl-2-methylpent-2-enoate (PubChem CID 154158605) has the molecular formula C8H15O5P
and a molecular weight of 222.18 g/mol. Its IUPAC name is phosphono 3-ethyl-2-methylpent-2-enoate.
Molecular Properties
| Compound Name | phosphono 3-ethyl-2-methylpent-2-enoate |
| PubChem CID | 154158605 |
| Molecular Formula | C8H15O5P |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | phosphono 3-ethyl-2-methylpent-2-enoate |
| SMILES | CCC(CC)=C(C)C(=O)OP(=O)(O)O |
| InChI | InChI=1S/C8H15O5P/c1-4-7(5-2)6(3)8(9)13-14(10,11)12/h4-5H2,1-3H3,(H2,10,11,12) |
| InChIKey | QJGPZXPLWDYPCX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphono 3-ethyl-2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphono 3-ethyl-2-methylpent-2-enoate?
The IUPAC name of phosphono 3-ethyl-2-methylpent-2-enoate (CID 154158605) is phosphono 3-ethyl-2-methylpent-2-enoate.
What is the SMILES notation for phosphono 3-ethyl-2-methylpent-2-enoate?
The canonical SMILES for phosphono 3-ethyl-2-methylpent-2-enoate is CCC(CC)=C(C)C(=O)OP(=O)(O)O.
What is the InChIKey of phosphono 3-ethyl-2-methylpent-2-enoate?
The InChIKey is QJGPZXPLWDYPCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O5P/c1-4-7(5-2)6(3)8(9)13-14(10,11)12/h4-5H2,1-3H3,(H2,10,11,12).
What are the key properties of phosphono 3-ethyl-2-methylpent-2-enoate?
phosphono 3-ethyl-2-methylpent-2-enoate has a molecular weight of 222.18 g/mol, XLogP of 1.76, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phosphono 3-ethyl-2-methylpent-2-enoate is sourced from PubChem (CID 154158605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).