About lithium;potassium;phosphono acetate
lithium;potassium;phosphono acetate (PubChem CID 71300541) has the molecular formula C2H5KLiO5P+2
and a molecular weight of 186.07 g/mol. Its IUPAC name is lithium;potassium;phosphono acetate.
Molecular Properties
| Compound Name | lithium;potassium;phosphono acetate |
| PubChem CID | 71300541 |
| Molecular Formula | C2H5KLiO5P+2 |
| Molecular Weight | 186.07 g/mol |
| Exact Mass | 185.97 |
| IUPAC Name | lithium;potassium;phosphono acetate |
| SMILES | CC(=O)OP(=O)(O)O.[K+].[Li+] |
| InChI | InChI=1S/C2H5O5P.K.Li/c1-2(3)7-8(4,5)6;;/h1H3,(H2,4,5,6);;/q;2*+1 |
| InChIKey | RLQMPLKXFIXRCV-UHFFFAOYSA-N |
| XLogP | -6.35 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.07 |
| LogP ≤ 5 | -6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;potassium;phosphono acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;potassium;phosphono acetate?
The IUPAC name of lithium;potassium;phosphono acetate (CID 71300541) is lithium;potassium;phosphono acetate.
What is the SMILES notation for lithium;potassium;phosphono acetate?
The canonical SMILES for lithium;potassium;phosphono acetate is CC(=O)OP(=O)(O)O.[K+].[Li+].
What is the InChIKey of lithium;potassium;phosphono acetate?
The InChIKey is RLQMPLKXFIXRCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5O5P.K.Li/c1-2(3)7-8(4,5)6;;/h1H3,(H2,4,5,6);;/q;2*+1.
What are the key properties of lithium;potassium;phosphono acetate?
lithium;potassium;phosphono acetate has a molecular weight of 186.07 g/mol, XLogP of -6.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;potassium;phosphono acetate is sourced from PubChem (CID 71300541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).