About diacetyloxyphosphoryl acetate;hydrate
diacetyloxyphosphoryl acetate;hydrate (PubChem CID 129021524) has the molecular formula C6H11O8P
and a molecular weight of 242.12 g/mol. Its IUPAC name is diacetyloxyphosphoryl acetate;hydrate.
Molecular Properties
| Compound Name | diacetyloxyphosphoryl acetate;hydrate |
| PubChem CID | 129021524 |
| Molecular Formula | C6H11O8P |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | diacetyloxyphosphoryl acetate;hydrate |
| SMILES | CC(=O)OP(=O)(OC(C)=O)OC(C)=O.O |
| InChI | InChI=1S/C6H9O7P.H2O/c1-4(7)11-14(10,12-5(2)8)13-6(3)9;/h1-3H3;1H2 |
| InChIKey | WHKCDERAVPGJNE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 127.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diacetyloxyphosphoryl acetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diacetyloxyphosphoryl acetate;hydrate?
The IUPAC name of diacetyloxyphosphoryl acetate;hydrate (CID 129021524) is diacetyloxyphosphoryl acetate;hydrate.
What is the SMILES notation for diacetyloxyphosphoryl acetate;hydrate?
The canonical SMILES for diacetyloxyphosphoryl acetate;hydrate is CC(=O)OP(=O)(OC(C)=O)OC(C)=O.O.
What is the InChIKey of diacetyloxyphosphoryl acetate;hydrate?
The InChIKey is WHKCDERAVPGJNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9O7P.H2O/c1-4(7)11-14(10,12-5(2)8)13-6(3)9;/h1-3H3;1H2.
What are the key properties of diacetyloxyphosphoryl acetate;hydrate?
diacetyloxyphosphoryl acetate;hydrate has a molecular weight of 242.12 g/mol, XLogP of -0.04, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diacetyloxyphosphoryl acetate;hydrate is sourced from PubChem (CID 129021524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).