About magnesium bis(diacetyl phosphate)
magnesium bis(diacetyl phosphate) (PubChem CID 71300565) has the molecular formula C8H12MgO12P2
and a molecular weight of 386.43 g/mol. Its IUPAC name is magnesium bis(diacetyl phosphate).
Molecular Properties
| Compound Name | magnesium bis(diacetyl phosphate) |
| PubChem CID | 71300565 |
| Molecular Formula | C8H12MgO12P2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | magnesium bis(diacetyl phosphate) |
| SMILES | CC(=O)OP(=O)([O-])OC(C)=O.CC(=O)OP(=O)([O-])OC(C)=O.[Mg+2] |
| InChI | InChI=1S/2C4H7O6P.Mg/c2*1-3(5)9-11(7,8)10-4(2)6;/h2*1-2H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | NHIPOTZPUMWEJB-UHFFFAOYSA-L |
| XLogP | -1.22 |
| TPSA | 185.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze magnesium bis(diacetyl phosphate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(diacetyl phosphate)?
The IUPAC name of magnesium bis(diacetyl phosphate) (CID 71300565) is magnesium bis(diacetyl phosphate).
What is the SMILES notation for magnesium bis(diacetyl phosphate)?
The canonical SMILES for magnesium bis(diacetyl phosphate) is CC(=O)OP(=O)([O-])OC(C)=O.CC(=O)OP(=O)([O-])OC(C)=O.[Mg+2].
What is the InChIKey of magnesium bis(diacetyl phosphate)?
The InChIKey is NHIPOTZPUMWEJB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H7O6P.Mg/c2*1-3(5)9-11(7,8)10-4(2)6;/h2*1-2H3,(H,7,8);/q;;+2/p-2.
What are the key properties of magnesium bis(diacetyl phosphate)?
magnesium bis(diacetyl phosphate) has a molecular weight of 386.43 g/mol, XLogP of -1.22, 4 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(diacetyl phosphate) is sourced from PubChem (CID 71300565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).